C19H26N2O3 — CID 97011465
N-[(1R,2S)-2-(hydroxymethyl)cycloheptyl]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 97011465) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[(1R,2S)-2-(hydroxymethyl)cycloheptyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(1R,2S)-2-(hydroxymethyl)cycloheptyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 97011465 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[(1R,2S)-2-(hydroxymethyl)cycloheptyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(N[C@@H]1CCCCC[C@@H]1CO)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C19H26N2O3/c22-13-15-6-2-1-3-9-17(15)20-19(24)14-7-4-8-16(12-14)21-11-5-10-18(21)23/h4,7-8,12,15,17,22H,1-3,5-6,9-11,13H2,(H,20,24)/t15-,17-/m1/s1 |
| InChIKey | BCUALNDQVNDXLS-NVXWUHKLSA-N |
| XLogP | 2.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |