C14H18BrNO2 — CID 103798593
3-bromo-N-[2-(hydroxymethyl)cyclohexyl]benzamide (PubChem CID 103798593) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 3-bromo-N-[2-(hydroxymethyl)cyclohexyl]benzamide.
| Compound Name | 3-bromo-N-[2-(hydroxymethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 103798593 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 3-bromo-N-[2-(hydroxymethyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCCCC1CO)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H18BrNO2/c15-12-6-3-5-10(8-12)14(18)16-13-7-2-1-4-11(13)9-17/h3,5-6,8,11,13,17H,1-2,4,7,9H2,(H,16,18) |
| InChIKey | GMFYFOYTHMEVER-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |