C13H15Br2NO2 — CID 103909256
3,5-dibromo-N-[2-(hydroxymethyl)cyclopentyl]benzamide (PubChem CID 103909256) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is 3,5-dibromo-N-[2-(hydroxymethyl)cyclopentyl]benzamide.
| Compound Name | 3,5-dibromo-N-[2-(hydroxymethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 103909256 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 3,5-dibromo-N-[2-(hydroxymethyl)cyclopentyl]benzamide |
| SMILES | O=C(NC1CCCC1CO)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H15Br2NO2/c14-10-4-9(5-11(15)6-10)13(18)16-12-3-1-2-8(12)7-17/h4-6,8,12,17H,1-3,7H2,(H,16,18) |
| InChIKey | KDHSBNFGKUCNFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |