C39H63N3O3 — CID 67992247
1-N,3-N,5-N-tris(2,3-diethylcyclohexyl)benzene-1,3,5-tricarboxamide (PubChem CID 67992247) has the molecular formula C39H63N3O3 and a molecular weight of 621.95 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2,3-diethylcyclohexyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(2,3-diethylcyclohexyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 67992247 |
| Molecular Formula | C39H63N3O3 |
| Molecular Weight | 621.95 g/mol |
| Exact Mass | 621.49 |
| IUPAC Name | 1-N,3-N,5-N-tris(2,3-diethylcyclohexyl)benzene-1,3,5-tricarboxamide |
| SMILES | CCC1CCCC(NC(=O)c2cc(C(=O)NC3CCCC(CC)C3CC)cc(C(=O)NC3CCCC(CC)C3CC)c2)C1CC |
| InChI | InChI=1S/C39H63N3O3/c1-7-25-16-13-19-34(31(25)10-4)40-37(43)28-22-29(38(44)41-35-20-14-17-26(8-2)32(35)11-5)24-30(23-28)39(45)42-36-21-15-18-27(9-3)33(36)12-6/h22-27,31-36H,7-21H2,1-6H3,(H,40,43)(H,41,44)(H,42,45) |
| InChIKey | CBDGRBSKZXCESE-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.95 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |