C13H16BrNO2 — CID 99636900
3-bromo-N-[(1S,2R)-2-hydroxycyclopentyl]-5-methylbenzamide (PubChem CID 99636900) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 3-bromo-N-[(1S,2R)-2-hydroxycyclopentyl]-5-methylbenzamide.
| Compound Name | 3-bromo-N-[(1S,2R)-2-hydroxycyclopentyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 99636900 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3-bromo-N-[(1S,2R)-2-hydroxycyclopentyl]-5-methylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)N[C@H]2CCC[C@H]2O)c1 |
| InChI | InChI=1S/C13H16BrNO2/c1-8-5-9(7-10(14)6-8)13(17)15-11-3-2-4-12(11)16/h5-7,11-12,16H,2-4H2,1H3,(H,15,17)/t11-,12+/m0/s1 |
| InChIKey | YBRQLUGPCSVCHY-NWDGAFQWSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |