C15H20BrNO4 — CID 104957285
4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-3,5-dimethoxybenzamide (PubChem CID 104957285) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is 4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 104957285 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@H]2CCCC[C@@H]2O)cc(OC)c1Br |
| InChI | InChI=1S/C15H20BrNO4/c1-20-12-7-9(8-13(21-2)14(12)16)15(19)17-10-5-3-4-6-11(10)18/h7-8,10-11,18H,3-6H2,1-2H3,(H,17,19)/t10-,11-/m0/s1 |
| InChIKey | ISRTXQWCLTXZPZ-QWRGUYRKSA-N |
| XLogP | 2.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |