C15H21NO4 — CID 104928008
N-[(1R,2R)-2-hydroxycyclohexyl]-2,6-dimethoxybenzamide (PubChem CID 104928008) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 104928008 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C15H21NO4/c1-19-12-8-5-9-13(20-2)14(12)15(18)16-10-6-3-4-7-11(10)17/h5,8-11,17H,3-4,6-7H2,1-2H3,(H,16,18)/t10-,11-/m1/s1 |
| InChIKey | MTXIIOAYDMTVKP-GHMZBOCLSA-N |
| XLogP | 1.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |