C14H18ClNO3 — CID 94413829
5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methoxybenzamide (PubChem CID 94413829) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 94413829 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C14H18ClNO3/c1-19-13-7-6-9(15)8-10(13)14(18)16-11-4-2-3-5-12(11)17/h6-8,11-12,17H,2-5H2,1H3,(H,16,18)/t11-,12-/m1/s1 |
| InChIKey | JWUIFYXIUOFGQH-VXGBXAGGSA-N |
| XLogP | 2.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |