C15H17ClF3NO2 — CID 25497376
5-chloro-2-methoxy-N-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 25497376) has the molecular formula C15H17ClF3NO2 and a molecular weight of 335.75 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 25497376 |
| Molecular Formula | C15H17ClF3NO2 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N[C@@H]1CCCC[C@H]1C(F)(F)F |
| InChI | InChI=1S/C15H17ClF3NO2/c1-22-13-7-6-9(16)8-10(13)14(21)20-12-5-3-2-4-11(12)15(17,18)19/h6-8,11-12H,2-5H2,1H3,(H,20,21)/t11-,12-/m1/s1 |
| InChIKey | ASUALTOORFMYAL-VXGBXAGGSA-N |
| XLogP | 4.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |