C16H22ClN3O2S — CID 8728826
1-[(5-chloro-2-methoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8728826) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[(5-chloro-2-methoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8728826 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[(5-chloro-2-methoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=S)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C16H22ClN3O2S/c1-10-5-3-4-6-13(10)18-16(23)20-19-15(21)12-9-11(17)7-8-14(12)22-2/h7-10,13H,3-6H2,1-2H3,(H,19,21)(H2,18,20,23)/t10-,13-/m1/s1 |
| InChIKey | PKTSXNBDRKJVNC-ZWNOBZJWSA-N |
| XLogP | 3.04 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|