C17H26N4O4S2 — CID 11945950
1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-methoxy-5-sulfamoylbenzoyl)amino]thiourea (PubChem CID 11945950) has the molecular formula C17H26N4O4S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-methoxy-5-sulfamoylbenzoyl)amino]thiourea.
| Compound Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-methoxy-5-sulfamoylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 11945950 |
| Molecular Formula | C17H26N4O4S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-methoxy-5-sulfamoylbenzoyl)amino]thiourea |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NNC(=S)N[C@H]1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C17H26N4O4S2/c1-10-5-4-6-14(11(10)2)19-17(26)21-20-16(22)13-9-12(27(18,23)24)7-8-15(13)25-3/h7-11,14H,4-6H2,1-3H3,(H,20,22)(H2,18,23,24)(H2,19,21,26)/t10-,11+,14-/m0/s1 |
| InChIKey | KVFNKBOTYQSPRA-WDMOLILDSA-N |
| XLogP | 1.28 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|