C16H21ClFN3OS — CID 11936447
1-[(5-chloro-2-fluorobenzoyl)amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11936447) has the molecular formula C16H21ClFN3OS and a molecular weight of 357.88 g/mol. Its IUPAC name is 1-[(5-chloro-2-fluorobenzoyl)amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[(5-chloro-2-fluorobenzoyl)amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11936447 |
| Molecular Formula | C16H21ClFN3OS |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-[(5-chloro-2-fluorobenzoyl)amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H21ClFN3OS/c1-9-4-3-5-14(10(9)2)19-16(23)21-20-15(22)12-8-11(17)6-7-13(12)18/h6-10,14H,3-5H2,1-2H3,(H,20,22)(H2,19,21,23)/t9-,10-,14+/m1/s1 |
| InChIKey | DJAJSHOIDLSVAS-RULNRJAQSA-N |
| XLogP | 3.41 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|