C15H19Cl2NO — CID 43007916
2,5-dichloro-N-(2,3-dimethylcyclohexyl)benzamide (PubChem CID 43007916) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,3-dimethylcyclohexyl)benzamide.
| Compound Name | 2,5-dichloro-N-(2,3-dimethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 43007916 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2,5-dichloro-N-(2,3-dimethylcyclohexyl)benzamide |
| SMILES | CC1CCCC(NC(=O)c2cc(Cl)ccc2Cl)C1C |
| InChI | InChI=1S/C15H19Cl2NO/c1-9-4-3-5-14(10(9)2)18-15(19)12-8-11(16)6-7-13(12)17/h6-10,14H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | BTBLAFBCKPTGNM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |