C15H19ClINO — CID 103221060
3-chloro-N-(2,3-dimethylcyclohexyl)-4-iodobenzamide (PubChem CID 103221060) has the molecular formula C15H19ClINO and a molecular weight of 391.68 g/mol. Its IUPAC name is 3-chloro-N-(2,3-dimethylcyclohexyl)-4-iodobenzamide.
| Compound Name | 3-chloro-N-(2,3-dimethylcyclohexyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 103221060 |
| Molecular Formula | C15H19ClINO |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 3-chloro-N-(2,3-dimethylcyclohexyl)-4-iodobenzamide |
| SMILES | CC1CCCC(NC(=O)c2ccc(I)c(Cl)c2)C1C |
| InChI | InChI=1S/C15H19ClINO/c1-9-4-3-5-14(10(9)2)18-15(19)11-6-7-13(17)12(16)8-11/h6-10,14H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | VBDDOUORCUBZJL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|