C15H21NO3 — CID 103955392
N-(2,3-dimethylcyclohexyl)-3,4-dihydroxybenzamide (PubChem CID 103955392) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-3,4-dihydroxybenzamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103955392 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-3,4-dihydroxybenzamide |
| SMILES | CC1CCCC(NC(=O)c2ccc(O)c(O)c2)C1C |
| InChI | InChI=1S/C15H21NO3/c1-9-4-3-5-12(10(9)2)16-15(19)11-6-7-13(17)14(18)8-11/h6-10,12,17-18H,3-5H2,1-2H3,(H,16,19) |
| InChIKey | BCKKYTSEMQARCU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|