C14H21N3O — CID 62156414
2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-carboxamide (PubChem CID 62156414) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62156414 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2ccnc(N)c2)C1C |
| InChI | InChI=1S/C14H21N3O/c1-9-4-3-5-12(10(9)2)17-14(18)11-6-7-16-13(15)8-11/h6-10,12H,3-5H2,1-2H3,(H2,15,16)(H,17,18) |
| InChIKey | ORIPTQAAABUDJQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |