C13H21N3O2S — CID 55044375
2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-sulfonamide (PubChem CID 55044375) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-sulfonamide.
| Compound Name | 2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 55044375 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-amino-N-(2,3-dimethylcyclohexyl)pyridine-4-sulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)c2ccnc(N)c2)C1C |
| InChI | InChI=1S/C13H21N3O2S/c1-9-4-3-5-12(10(9)2)16-19(17,18)11-6-7-15-13(14)8-11/h6-10,12,16H,3-5H2,1-2H3,(H2,14,15) |
| InChIKey | KXYNZZONZCLZPI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |