C13H19ClN2O2S — CID 124835688
6-chloro-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]pyridine-3-sulfonamide (PubChem CID 124835688) has the molecular formula C13H19ClN2O2S and a molecular weight of 302.83 g/mol. Its IUPAC name is 6-chloro-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 124835688 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-chloro-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]pyridine-3-sulfonamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NS(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H19ClN2O2S/c1-9-4-3-5-12(10(9)2)16-19(17,18)11-6-7-13(14)15-8-11/h6-10,12,16H,3-5H2,1-2H3/t9-,10+,12-/m1/s1 |
| InChIKey | DZFKCTMRVXTCJY-JFGNBEQYSA-N |
| XLogP | 2.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|