C12H14ClF3N2O2S — CID 60722058
6-chloro-N-[2-(trifluoromethyl)cyclohexyl]pyridine-3-sulfonamide (PubChem CID 60722058) has the molecular formula C12H14ClF3N2O2S and a molecular weight of 342.77 g/mol. Its IUPAC name is 6-chloro-N-[2-(trifluoromethyl)cyclohexyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[2-(trifluoromethyl)cyclohexyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60722058 |
| Molecular Formula | C12H14ClF3N2O2S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 6-chloro-N-[2-(trifluoromethyl)cyclohexyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1C(F)(F)F)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H14ClF3N2O2S/c13-11-6-5-8(7-17-11)21(19,20)18-10-4-2-1-3-9(10)12(14,15)16/h5-7,9-10,18H,1-4H2 |
| InChIKey | KZLHQUPJELYACC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|