C8H8ClF3N2O2S — CID 86668141
6-chloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyridine-3-sulfonamide (PubChem CID 86668141) has the molecular formula C8H8ClF3N2O2S and a molecular weight of 288.68 g/mol. Its IUPAC name is 6-chloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 86668141 |
| Molecular Formula | C8H8ClF3N2O2S |
| Molecular Weight | 288.68 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 6-chloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyridine-3-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C8H8ClF3N2O2S/c1-5(8(10,11)12)14-17(15,16)6-2-3-7(9)13-4-6/h2-5,14H,1H3/t5-/m1/s1 |
| InChIKey | RMHQXULHALBZPQ-RXMQYKEDSA-N |
| XLogP | 1.96 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|