C8H11ClN2O4S — CID 65314396
6-chloro-N-(1,3-dihydroxypropan-2-yl)pyridine-3-sulfonamide (PubChem CID 65314396) has the molecular formula C8H11ClN2O4S and a molecular weight of 266.71 g/mol. Its IUPAC name is 6-chloro-N-(1,3-dihydroxypropan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(1,3-dihydroxypropan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 65314396 |
| Molecular Formula | C8H11ClN2O4S |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 6-chloro-N-(1,3-dihydroxypropan-2-yl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC(CO)CO)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H11ClN2O4S/c9-8-2-1-7(3-10-8)16(14,15)11-6(4-12)5-13/h1-3,6,11-13H,4-5H2 |
| InChIKey | UPQAKUMRSIAOHZ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|