C13H14Cl2N4O4S2 — CID 4729949
6-chloro-N-[3-[(6-chloro-3-pyridinyl)sulfonylamino]propyl]pyridine-3-sulfonamide (PubChem CID 4729949) has the molecular formula C13H14Cl2N4O4S2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 6-chloro-N-[3-[(6-chloro-3-pyridinyl)sulfonylamino]propyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[3-[(6-chloro-3-pyridinyl)sulfonylamino]propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4729949 |
| Molecular Formula | C13H14Cl2N4O4S2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 6-chloro-N-[3-[(6-chloro-3-pyridinyl)sulfonylamino]propyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCCNS(=O)(=O)c1ccc(Cl)nc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H14Cl2N4O4S2/c14-12-4-2-10(8-16-12)24(20,21)18-6-1-7-19-25(22,23)11-3-5-13(15)17-9-11/h2-5,8-9,18-19H,1,6-7H2 |
| InChIKey | HJNNZQAZTYGMLO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|