C13H14ClN3O2S — CID 110408505
6-chloro-N-(3-pyridin-3-ylpropyl)pyridine-3-sulfonamide (PubChem CID 110408505) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 6-chloro-N-(3-pyridin-3-ylpropyl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(3-pyridin-3-ylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110408505 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 6-chloro-N-(3-pyridin-3-ylpropyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCCc1cccnc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H14ClN3O2S/c14-13-6-5-12(10-16-13)20(18,19)17-8-2-4-11-3-1-7-15-9-11/h1,3,5-7,9-10,17H,2,4,8H2 |
| InChIKey | UBYYLRAVJHHHME-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|