C12H17ClN2O4S — CID 60639366
methyl 2-[(6-chloro-3-pyridinyl)sulfonylamino]-3-methylpentanoate (PubChem CID 60639366) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is methyl 2-[(6-chloro-3-pyridinyl)sulfonylamino]-3-methylpentanoate.
| Compound Name | methyl 2-[(6-chloro-3-pyridinyl)sulfonylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 60639366 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | methyl 2-[(6-chloro-3-pyridinyl)sulfonylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(Cl)nc1)C(=O)OC |
| InChI | InChI=1S/C12H17ClN2O4S/c1-4-8(2)11(12(16)19-3)15-20(17,18)9-5-6-10(13)14-7-9/h5-8,11,15H,4H2,1-3H3 |
| InChIKey | CWDKPLXJNPTFIY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|