C15H19ClN2O5 — CID 9201670
[2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 9201670) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is [2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9201670 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)COC(=O)c1ccc(Cl)nc1)C(=O)OC |
| InChI | InChI=1S/C15H19ClN2O5/c1-4-9(2)13(15(21)22-3)18-12(19)8-23-14(20)10-5-6-11(16)17-7-10/h5-7,9,13H,4,8H2,1-3H3,(H,18,19)/t9-,13+/m1/s1 |
| InChIKey | DQRHZOJTQHZFGO-RNCFNFMXSA-N |
| XLogP | 1.60 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|