C16H20ClNO5 — CID 18201042
[2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 3-chlorobenzoate (PubChem CID 18201042) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 18201042 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 3-chlorobenzoate |
| SMILES | CCC(C)C(NC(=O)COC(=O)c1cccc(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C16H20ClNO5/c1-4-10(2)14(16(21)22-3)18-13(19)9-23-15(20)11-6-5-7-12(17)8-11/h5-8,10,14H,4,9H2,1-3H3,(H,18,19) |
| InChIKey | POWHTWIURDDFNZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |