C17H22ClNO6 — CID 18201939
[2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate (PubChem CID 18201939) has the molecular formula C17H22ClNO6 and a molecular weight of 371.82 g/mol. Its IUPAC name is [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 18201939 |
| Molecular Formula | C17H22ClNO6 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate |
| SMILES | CCC(C)C(NC(=O)COC(=O)c1cc(Cl)ccc1OC)C(=O)OC |
| InChI | InChI=1S/C17H22ClNO6/c1-5-10(2)15(17(22)24-4)19-14(20)9-25-16(21)12-8-11(18)6-7-13(12)23-3/h6-8,10,15H,5,9H2,1-4H3,(H,19,20) |
| InChIKey | DRTGCKFKAFLPBK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |