C16H19ClN2O7 — CID 9015630
[2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 9015630) has the molecular formula C16H19ClN2O7 and a molecular weight of 386.79 g/mol. Its IUPAC name is [2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate.
| Compound Name | [2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 9015630 |
| Molecular Formula | C16H19ClN2O7 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [2-[[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | CC[C@@H](C)C(NC(=O)COC(=O)c1ccc(Cl)cc1[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C16H19ClN2O7/c1-4-9(2)14(16(22)25-3)18-13(20)8-26-15(21)11-6-5-10(17)7-12(11)19(23)24/h5-7,9,14H,4,8H2,1-3H3,(H,18,20)/t9-,14?/m1/s1 |
| InChIKey | VYFIEJLQRBDNTA-UCWRFOARSA-N |
| XLogP | 2.11 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|