C17H14Cl2N2O5 — CID 55314955
[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate (PubChem CID 55314955) has the molecular formula C17H14Cl2N2O5 and a molecular weight of 397.21 g/mol. Its IUPAC name is [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 55314955 |
| Molecular Formula | C17H14Cl2N2O5 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
| SMILES | CC(NC(=O)COC(=O)c1cc(Cl)ccc1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O5/c1-10(11-2-4-12(18)5-3-11)20-16(22)9-26-17(23)14-8-13(19)6-7-15(14)21(24)25/h2-8,10H,9H2,1H3,(H,20,22) |
| InChIKey | IKORGUJQAAFPPN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|