C14H17ClN2O5 — CID 2640518
[2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 2640518) has the molecular formula C14H17ClN2O5 and a molecular weight of 328.75 g/mol. Its IUPAC name is [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate.
| Compound Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 2640518 |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | CC(C)[C@@H](C)NC(=O)COC(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17ClN2O5/c1-8(2)9(3)16-13(18)7-22-14(19)11-5-4-10(15)6-12(11)17(20)21/h4-6,8-9H,7H2,1-3H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | VXHWCHCPPILUCM-SECBINFHSA-N |
| XLogP | 2.57 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|