C12H11ClN2O7 — CID 2590130
[2-(ethoxycarbonylamino)-2-oxoethyl] 5-chloro-2-nitrobenzoate (PubChem CID 2590130) has the molecular formula C12H11ClN2O7 and a molecular weight of 330.68 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 2590130 |
| Molecular Formula | C12H11ClN2O7 |
| Molecular Weight | 330.68 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 5-chloro-2-nitrobenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11ClN2O7/c1-2-21-12(18)14-10(16)6-22-11(17)8-5-7(13)3-4-9(8)15(19)20/h3-5H,2,6H2,1H3,(H,14,16,18) |
| InChIKey | KTCPXPZAROHINU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.68 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|