C12H13N3O7 — CID 8894565
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 8894565) has the molecular formula C12H13N3O7 and a molecular weight of 311.25 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 8894565 |
| Molecular Formula | C12H13N3O7 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O7/c1-2-21-12(18)14-10(16)6-22-11(17)7-3-4-8(13)9(5-7)15(19)20/h3-5H,2,6,13H2,1H3,(H,14,16,18) |
| InChIKey | IJCSPSQKQCYNLU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|