C12H12N2O7 — CID 2501944
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-nitrobenzoate (PubChem CID 2501944) has the molecular formula C12H12N2O7 and a molecular weight of 296.24 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 2501944 |
| Molecular Formula | C12H12N2O7 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-nitrobenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O7/c1-2-20-12(17)13-10(15)7-21-11(16)8-3-5-9(6-4-8)14(18)19/h3-6H,2,7H2,1H3,(H,13,15,17) |
| InChIKey | MCROKLQSCMGGHW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|