C13H13NO6 — CID 2504377
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-formylbenzoate (PubChem CID 2504377) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 2504377 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-formylbenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C13H13NO6/c1-2-19-13(18)14-11(16)8-20-12(17)10-5-3-9(7-15)4-6-10/h3-7H,2,8H2,1H3,(H,14,16,18) |
| InChIKey | COIXWSJGTGHYNM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|