C13H13N5O5 — CID 2535658
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-(tetrazol-1-yl)benzoate (PubChem CID 2535658) has the molecular formula C13H13N5O5 and a molecular weight of 319.28 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 2535658 |
| Molecular Formula | C13H13N5O5 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C13H13N5O5/c1-2-22-13(21)15-11(19)7-23-12(20)9-3-5-10(6-4-9)18-8-14-16-17-18/h3-6,8H,2,7H2,1H3,(H,15,19,21) |
| InChIKey | CBLISMFAXGWXTB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |