C21H24N6O3 — CID 2535814
[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate (PubChem CID 2535814) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 2535814 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
| SMILES | CCN(c1ccc(NC(=O)COC(=O)c2ccc(-n3cnnn3)cc2)cc1)C(C)C |
| InChI | InChI=1S/C21H24N6O3/c1-4-26(15(2)3)18-11-7-17(8-12-18)23-20(28)13-30-21(29)16-5-9-19(10-6-16)27-14-22-24-25-27/h5-12,14-15H,4,13H2,1-3H3,(H,23,28) |
| InChIKey | HTXHRHBPXLCHQL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |