C25H27N3O4S — CID 30118695
[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate (PubChem CID 30118695) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 30118695 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate |
| SMILES | CCN(c1ccc(NC(=O)COC(=O)c2ccc(NC(=O)c3cccs3)cc2)cc1)C(C)C |
| InChI | InChI=1S/C25H27N3O4S/c1-4-28(17(2)3)21-13-11-19(12-14-21)26-23(29)16-32-25(31)18-7-9-20(10-8-18)27-24(30)22-6-5-15-33-22/h5-15,17H,4,16H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | XBPFRSLORKXRGL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |