C16H15NO3S — CID 18122532
2-methylprop-2-enyl 4-(thiophene-2-carbonylamino)benzoate (PubChem CID 18122532) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-methylprop-2-enyl 4-(thiophene-2-carbonylamino)benzoate.
| Compound Name | 2-methylprop-2-enyl 4-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 18122532 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-methylprop-2-enyl 4-(thiophene-2-carbonylamino)benzoate |
| SMILES | C=C(C)COC(=O)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H15NO3S/c1-11(2)10-20-16(19)12-5-7-13(8-6-12)17-15(18)14-4-3-9-21-14/h3-9H,1,10H2,2H3,(H,17,18) |
| InChIKey | ZZWNCJUBDMBLBX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|