C15H15NO3S — CID 718334
propan-2-yl 4-(thiophene-2-carbonylamino)benzoate (PubChem CID 718334) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is propan-2-yl 4-(thiophene-2-carbonylamino)benzoate.
| Compound Name | propan-2-yl 4-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 718334 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | propan-2-yl 4-(thiophene-2-carbonylamino)benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H15NO3S/c1-10(2)19-15(18)11-5-7-12(8-6-11)16-14(17)13-4-3-9-20-13/h3-10H,1-2H3,(H,16,17) |
| InChIKey | WAQYIWPVXHYBOA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |