C21H17ClN2O4S — CID 27965444
[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate (PubChem CID 27965444) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 27965444 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(NC(=O)c2cccs2)cc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H17ClN2O4S/c1-13(19(25)24-17-6-3-2-5-16(17)22)28-21(27)14-8-10-15(11-9-14)23-20(26)18-7-4-12-29-18/h2-13H,1H3,(H,23,26)(H,24,25)/t13-/m0/s1 |
| InChIKey | DCLMCRLOFOHOPD-ZDUSSCGKSA-N |
| XLogP | 4.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |