C21H23N3O5S — CID 43015410
[1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate (PubChem CID 43015410) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 43015410 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(thiophene-2-carbonylamino)benzoate |
| SMILES | CC(OC(=O)c1ccc(NC(=O)c2cccs2)cc1)C(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C21H23N3O5S/c1-13(18(25)24-21(28)23-15-5-2-3-6-15)29-20(27)14-8-10-16(11-9-14)22-19(26)17-7-4-12-30-17/h4,7-13,15H,2-3,5-6H2,1H3,(H,22,26)(H2,23,24,25,28) |
| InChIKey | OOACXHMQUMDKJU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |