C13H12F3NO5 — CID 7505912
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-(trifluoromethyl)benzoate (PubChem CID 7505912) has the molecular formula C13H12F3NO5 and a molecular weight of 319.24 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7505912 |
| Molecular Formula | C13H12F3NO5 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12F3NO5/c1-2-21-12(20)17-10(18)7-22-11(19)8-3-5-9(6-4-8)13(14,15)16/h3-6H,2,7H2,1H3,(H,17,18,20) |
| InChIKey | CNOLAGXAUQBJDT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |