C14H15FN2O6 — CID 7877735
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate (PubChem CID 7877735) has the molecular formula C14H15FN2O6 and a molecular weight of 326.28 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7877735 |
| Molecular Formula | C14H15FN2O6 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O6/c1-2-22-14(21)17-11(18)8-23-12(19)7-16-13(20)9-3-5-10(15)6-4-9/h3-6H,2,7-8H2,1H3,(H,16,20)(H,17,18,21) |
| InChIKey | ZUWWLYFYSATVEI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |