C16H20FN3O5 — CID 7878278
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate (PubChem CID 7878278) has the molecular formula C16H20FN3O5 and a molecular weight of 353.35 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7878278 |
| Molecular Formula | C16H20FN3O5 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FN3O5/c1-3-10(2)19-16(24)20-13(21)9-25-14(22)8-18-15(23)11-4-6-12(17)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H,18,23)(H2,19,20,21,24)/t10-/m0/s1 |
| InChIKey | RDLMYKCCJQNXQY-JTQLQIEISA-N |
| XLogP | 0.72 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |