C16H20ClN3O5 — CID 7878911
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate (PubChem CID 7878911) has the molecular formula C16H20ClN3O5 and a molecular weight of 369.81 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7878911 |
| Molecular Formula | C16H20ClN3O5 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)CNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O5/c1-10(2)7-19-16(24)20-13(21)9-25-14(22)8-18-15(23)11-3-5-12(17)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,18,23)(H2,19,20,21,24) |
| InChIKey | XAUTZLJTNCWMIH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |