C14H19N3O5S — CID 7808026
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate (PubChem CID 7808026) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7808026 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H19N3O5S/c1-9(2)6-16-14(21)17-11(18)8-22-12(19)7-15-13(20)10-4-3-5-23-10/h3-5,9H,6-8H2,1-2H3,(H,15,20)(H2,16,17,18,21) |
| InChIKey | MGMIKRQGTKQKLI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |