C16H13F3N2O4S — CID 2478990
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(thiophene-2-carbonylamino)acetate (PubChem CID 2478990) has the molecular formula C16H13F3N2O4S and a molecular weight of 386.35 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 2478990 |
| Molecular Formula | C16H13F3N2O4S |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(thiophene-2-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1cccs1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O4S/c17-16(18,19)10-4-1-2-5-11(10)21-13(22)9-25-14(23)8-20-15(24)12-6-3-7-26-12/h1-7H,8-9H2,(H,20,24)(H,21,22) |
| InChIKey | LUYSNGQUSUTIEO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |