C11H13N3O5S — CID 8662200
[2-(2-acetylhydrazinyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate (PubChem CID 8662200) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 8662200 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
| SMILES | CC(=O)NNC(=O)COC(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C11H13N3O5S/c1-7(15)13-14-9(16)6-19-10(17)5-12-11(18)8-3-2-4-20-8/h2-4H,5-6H2,1H3,(H,12,18)(H,13,15)(H,14,16) |
| InChIKey | CSRWQCUUHUWIEH-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|