C14H12BrN3O6S — CID 2082274
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate (PubChem CID 2082274) has the molecular formula C14H12BrN3O6S and a molecular weight of 430.24 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 2082274 |
| Molecular Formula | C14H12BrN3O6S |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Br)o1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H12BrN3O6S/c15-10-4-3-8(24-10)13(21)16-6-12(20)23-7-11(19)17-18-14(22)9-2-1-5-25-9/h1-5H,6-7H2,(H,16,21)(H,17,19)(H,18,22) |
| InChIKey | UWGOSXMHSRPJOE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|