C17H15BrClN3O7 — CID 2457418
[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate (PubChem CID 2457418) has the molecular formula C17H15BrClN3O7 and a molecular weight of 488.68 g/mol. Its IUPAC name is [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate.
| Compound Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 2457418 |
| Molecular Formula | C17H15BrClN3O7 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)COC(=O)CNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C17H15BrClN3O7/c1-27-11-3-2-9(19)6-10(11)16(25)22-21-14(23)8-28-15(24)7-20-17(26)12-4-5-13(18)29-12/h2-6H,7-8H2,1H3,(H,20,26)(H,21,23)(H,22,25) |
| InChIKey | KIQSEZQSYGOLAY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|